C24H19F13S3 — CID 23519286
3-methyl-2,5-bis(5-methylthiophen-2-yl)-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)thiophene (PubChem CID 23519286) has the molecular formula C24H19F13S3 and a molecular weight of 650.59 g/mol. Its IUPAC name is 3-methyl-2,5-bis(5-methylthiophen-2-yl)-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)thiophene.
| Compound Name | 3-methyl-2,5-bis(5-methylthiophen-2-yl)-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)thiophene |
|---|---|
| PubChem CID | 23519286 |
| Molecular Formula | C24H19F13S3 |
| Molecular Weight | 650.59 g/mol |
| Exact Mass | 650.04 |
| IUPAC Name | 3-methyl-2,5-bis(5-methylthiophen-2-yl)-4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)thiophene |
| SMILES | Cc1ccc(-c2sc(-c3ccc(C)s3)c(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2C)s1 |
| InChI | InChI=1S/C24H19F13S3/c1-11-6-8-15(38-11)17-13(3)14(18(40-17)16-9-7-12(2)39-16)5-4-10-19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | WOXQTVVEUNFGQA-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.59 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|