About 2-azido-2,6-dimethylheptane
2-azido-2,6-dimethylheptane (PubChem CID 23519410) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-azido-2,6-dimethylheptane.
Molecular Properties
| Compound Name | 2-azido-2,6-dimethylheptane |
| PubChem CID | 23519410 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 2-azido-2,6-dimethylheptane |
| SMILES | CC(C)CCCC(C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C9H19N3/c1-8(2)6-5-7-9(3,4)11-12-10/h8H,5-7H2,1-4H3 |
| InChIKey | RZJCNWPSXHOLET-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-2,6-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-2,6-dimethylheptane?
The IUPAC name of 2-azido-2,6-dimethylheptane (CID 23519410) is 2-azido-2,6-dimethylheptane.
What is the SMILES notation for 2-azido-2,6-dimethylheptane?
The canonical SMILES for 2-azido-2,6-dimethylheptane is CC(C)CCCC(C)(C)N=[N+]=[N-].
What is the InChIKey of 2-azido-2,6-dimethylheptane?
The InChIKey is RZJCNWPSXHOLET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3/c1-8(2)6-5-7-9(3,4)11-12-10/h8H,5-7H2,1-4H3.
What are the key properties of 2-azido-2,6-dimethylheptane?
2-azido-2,6-dimethylheptane has a molecular weight of 169.27 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-2,6-dimethylheptane is sourced from PubChem (CID 23519410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).