C23H30N4O7 — CID 23519622
[(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 3,4,5-trimethoxybenzoate (PubChem CID 23519622) has the molecular formula C23H30N4O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is [(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 23519622 |
| Molecular Formula | C23H30N4O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | [(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@H](C)CCCCn2c(=O)c3c(ncn3C)n(C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H30N4O7/c1-14(34-22(29)15-11-16(31-4)19(33-6)17(12-15)32-5)9-7-8-10-27-21(28)18-20(24-13-25(18)2)26(3)23(27)30/h11-14H,7-10H2,1-6H3/t14-/m1/s1 |
| InChIKey | QODBGBUDEJMWSI-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 115.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|