About 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate
2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate (PubChem CID 23519704) has the molecular formula C23H40N2O3
and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate.
Molecular Properties
| Compound Name | 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate |
| PubChem CID | 23519704 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate |
| SMILES | CCCC(CN[C@@H](CC)C(N)=O)CC(=O)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H40N2O3/c1-3-5-16(15-25-20(4-2)22(24)27)11-21(26)28-7-6-23-12-17-8-18(13-23)10-19(9-17)14-23/h16-20,25H,3-15H2,1-2H3,(H2,24,27)/t16?,17?,18?,19?,20-,23?/m0/s1 |
| InChIKey | NILNQLNUNOEUEN-BEUFSINWSA-N |
| XLogP | 3.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate?
The IUPAC name of 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate (CID 23519704) is 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate.
What is the SMILES notation for 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate?
The canonical SMILES for 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate is CCCC(CN[C@@H](CC)C(N)=O)CC(=O)OCCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate?
The InChIKey is NILNQLNUNOEUEN-BEUFSINWSA-N. The full InChI is InChI=1S/C23H40N2O3/c1-3-5-16(15-25-20(4-2)22(24)27)11-21(26)28-7-6-23-12-17-8-18(13-23)10-19(9-17)14-23/h16-20,25H,3-15H2,1-2H3,(H2,24,27)/t16?,17?,18?,19?,20-,23?/m0/s1.
What are the key properties of 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate?
2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate has a molecular weight of 392.58 g/mol, XLogP of 3.80, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)ethyl 3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate is sourced from PubChem (CID 23519704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).