C7H5F7O2 — CID 23519710
(E)-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid (PubChem CID 23519710) has the molecular formula C7H5F7O2 and a molecular weight of 254.10 g/mol. Its IUPAC name is (E)-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid.
| Compound Name | (E)-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 23519710 |
| Molecular Formula | C7H5F7O2 |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (E)-4,5,5,5-tetrafluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid |
| SMILES | C/C(=C\C(F)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H5F7O2/c1-3(4(15)16)2-5(8,6(9,10)11)7(12,13)14/h2H,1H3,(H,15,16)/b3-2+ |
| InChIKey | XXZOPUDYQZUIAE-NSCUHMNNSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|