C22H20Cl2N4O6 — CID 23519804
5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide (PubChem CID 23519804) has the molecular formula C22H20Cl2N4O6 and a molecular weight of 507.33 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide.
| Compound Name | 5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 23519804 |
| Molecular Formula | C22H20Cl2N4O6 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cc(Oc2c(Cl)cc(-n3ncc(=O)[nH]c3=O)cc2Cl)ccc1O |
| InChI | InChI=1S/C22H20Cl2N4O6/c23-14-7-11(28-22(33)27-19(31)10-25-28)8-15(24)20(14)34-12-5-6-17(29)13(9-12)21(32)26-16-3-1-2-4-18(16)30/h5-10,16,18,29-30H,1-4H2,(H,26,32)(H,27,31,33)/t16-,18-/m1/s1 |
| InChIKey | GMGOEXDEZRTPFR-SJLPKXTDSA-N |
| XLogP | 2.76 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |