C32H46N2O2 — CID 23519813
(8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(3-pyridin-3-ylpropyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 23519813) has the molecular formula C32H46N2O2 and a molecular weight of 490.73 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(3-pyridin-3-ylpropyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(3-pyridin-3-ylpropyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 23519813 |
| Molecular Formula | C32H46N2O2 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-13-methyl-11-[5-[methyl(3-pyridin-3-ylpropyl)amino]pentyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(CCCCC[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12)CCCc1cccnc1 |
| InChI | InChI=1S/C32H46N2O2/c1-32-21-25(10-4-3-5-18-34(2)19-7-9-23-8-6-17-33-22-23)31-27-14-12-26(35)20-24(27)11-13-28(31)29(32)15-16-30(32)36/h6,8,12,14,17,20,22,25,28-31,35-36H,3-5,7,9-11,13,15-16,18-19,21H2,1-2H3/t25-,28-,29-,30-,31+,32-/m0/s1 |
| InChIKey | VLGKXBHFTYZZEX-HKJUBNQKSA-N |
| XLogP | 6.36 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|