C13H14F3NO3S — CID 23519858
(2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid (PubChem CID 23519858) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 23519858 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1C[C@H](S)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H14F3NO3S/c14-10-3-12(16)11(15)1-7(10)5-20-6-8-2-9(21)4-17(8)13(18)19/h1,3,8-9,21H,2,4-6H2,(H,18,19)/t8-,9+/m0/s1 |
| InChIKey | BVVGPVNOONJVFD-DTWKUNHWSA-N |
| XLogP | 2.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|