About [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 2352010) has the molecular formula C19H18N2O6
and a molecular weight of 370.36 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate.
Molecular Properties
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate |
| PubChem CID | 2352010 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N2O6/c22-17(20-9-13-6-7-15-16(8-13)27-12-26-15)11-25-18(23)10-21-19(24)14-4-2-1-3-5-14/h1-8H,9-12H2,(H,20,22)(H,21,24) |
| InChIKey | WGHFYRPUFSDRFW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate?
The IUPAC name of [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate (CID 2352010) is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate.
What is the SMILES notation for [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate?
The canonical SMILES for [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate is O=C(COC(=O)CNC(=O)c1ccccc1)NCc1ccc2c(c1)OCO2.
What is the InChIKey of [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate?
The InChIKey is WGHFYRPUFSDRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O6/c22-17(20-9-13-6-7-15-16(8-13)27-12-26-15)11-25-18(23)10-21-19(24)14-4-2-1-3-5-14/h1-8H,9-12H2,(H,20,22)(H,21,24).
What are the key properties of [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate?
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate has a molecular weight of 370.36 g/mol, XLogP of 1.00, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-benzamidoacetate is sourced from PubChem (CID 2352010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).