About (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid
(3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid (PubChem CID 23520168) has the molecular formula C17H29NO6
and a molecular weight of 343.42 g/mol. Its IUPAC name is (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid.
Molecular Properties
| Compound Name | (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid |
| PubChem CID | 23520168 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid |
| SMILES | CCCC[C@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO6/c1-5-6-7-11(8-14(20)21)15(22)18-10-12(19)9-13(18)16(23)24-17(2,3)4/h11-13,19H,5-10H2,1-4H3,(H,20,21)/t11-,12-,13+/m1/s1 |
| InChIKey | XPVZXPMGUBVTSX-UPJWGTAASA-N |
| XLogP | 1.57 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid?
The IUPAC name of (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid (CID 23520168) is (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid.
What is the SMILES notation for (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid?
The canonical SMILES for (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid is CCCC[C@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)OC(C)(C)C.
What is the InChIKey of (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid?
The InChIKey is XPVZXPMGUBVTSX-UPJWGTAASA-N. The full InChI is InChI=1S/C17H29NO6/c1-5-6-7-11(8-14(20)21)15(22)18-10-12(19)9-13(18)16(23)24-17(2,3)4/h11-13,19H,5-10H2,1-4H3,(H,20,21)/t11-,12-,13+/m1/s1.
What are the key properties of (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid?
(3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid has a molecular weight of 343.42 g/mol, XLogP of 1.57, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(2S,4R)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-1-carbonyl]heptanoic acid is sourced from PubChem (CID 23520168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).