C18H31N3O5 — CID 23520230
(2S,3R)-N,2-dihydroxy-3-[(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbonyl]heptanamide (PubChem CID 23520230) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbonyl]heptanamide.
| Compound Name | (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbonyl]heptanamide |
|---|---|
| PubChem CID | 23520230 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2S,3R)-N,2-dihydroxy-3-[(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbonyl]heptanamide |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)N1CCCCC1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C18H31N3O5/c1-2-3-8-13(15(22)16(23)19-26)17(24)21-12-7-9-14(21)18(25)20-10-5-4-6-11-20/h13-15,22,26H,2-12H2,1H3,(H,19,23)/t13-,14+,15+/m1/s1 |
| InChIKey | SWGNLZZWRNXEQF-ILXRZTDVSA-N |
| XLogP | 0.66 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|