C21H26F6O3 — CID 23520705
tert-butyl [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] carbonate (PubChem CID 23520705) has the molecular formula C21H26F6O3 and a molecular weight of 440.42 g/mol. Its IUPAC name is tert-butyl [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] carbonate.
| Compound Name | tert-butyl [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] carbonate |
|---|---|
| PubChem CID | 23520705 |
| Molecular Formula | C21H26F6O3 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | tert-butyl [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC(CC1CC2CC1C1C3C=CC(C3)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H26F6O3/c1-18(2,3)29-17(28)30-19(20(22,23)24,21(25,26)27)9-13-7-12-8-14(13)16-11-5-4-10(6-11)15(12)16/h4-5,10-16H,6-9H2,1-3H3 |
| InChIKey | WPBDHJJOEQFEAU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|