C18H20F6O2 — CID 23520707
[1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] acetate (PubChem CID 23520707) has the molecular formula C18H20F6O2 and a molecular weight of 382.34 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] acetate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 23520707 |
| Molecular Formula | C18H20F6O2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl)propan-2-yl] acetate |
| SMILES | CC(=O)OC(CC1CC2CC1C1C3C=CC(C3)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H20F6O2/c1-8(25)26-16(17(19,20)21,18(22,23)24)7-12-5-11-6-13(12)15-10-3-2-9(4-10)14(11)15/h2-3,9-15H,4-7H2,1H3 |
| InChIKey | IOWJUZJHNCMZLD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|