C32H41F11O6 — CID 23520732
tert-butyl 2-[[3-methyl-5-(2,2,4,4,4-pentafluoro-1,3,3-trihydroxybutyl)-2-bicyclo[2.2.1]heptanyl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-2-(trifluoromethyl)pentanoate (PubChem CID 23520732) has the molecular formula C32H41F11O6 and a molecular weight of 730.65 g/mol. Its IUPAC name is tert-butyl 2-[[3-methyl-5-(2,2,4,4,4-pentafluoro-1,3,3-trihydroxybutyl)-2-bicyclo[2.2.1]heptanyl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-2-(trifluoromethyl)pentanoate.
| Compound Name | tert-butyl 2-[[3-methyl-5-(2,2,4,4,4-pentafluoro-1,3,3-trihydroxybutyl)-2-bicyclo[2.2.1]heptanyl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-2-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 23520732 |
| Molecular Formula | C32H41F11O6 |
| Molecular Weight | 730.65 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | tert-butyl 2-[[3-methyl-5-(2,2,4,4,4-pentafluoro-1,3,3-trihydroxybutyl)-2-bicyclo[2.2.1]heptanyl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-2-(trifluoromethyl)pentanoate |
| SMILES | CC(CC(CC1C2CC(C1C)C(C(O)C(F)(F)C(O)(O)C(F)(F)F)C2)(C(=O)OC(C)(C)C)C(F)(F)F)c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H41F11O6/c1-15(17-7-9-19(10-8-17)26(6,46)30(35,36)37)13-27(31(38,39)40,24(45)49-25(3,4)5)14-22-16(2)20-11-18(22)12-21(20)23(44)28(33,34)29(47,48)32(41,42)43/h7-10,15-16,18,20-23,44,46-48H,11-14H2,1-6H3 |
| InChIKey | RHCJBPANXWHSGY-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|