About 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole
4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole (PubChem CID 23521304) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole |
| PubChem CID | 23521304 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole |
| SMILES | CN1C=CC2SC=CC21 |
| InChI | InChI=1S/C7H9NS/c1-8-4-2-7-6(8)3-5-9-7/h2-7H,1H3 |
| InChIKey | BCFSNZYFASZEHB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole?
The IUPAC name of 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole (CID 23521304) is 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole.
What is the SMILES notation for 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole?
The canonical SMILES for 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole is CN1C=CC2SC=CC21.
What is the InChIKey of 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole?
The InChIKey is BCFSNZYFASZEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS/c1-8-4-2-7-6(8)3-5-9-7/h2-7H,1H3.
What are the key properties of 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole?
4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole has a molecular weight of 139.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3a,6a-dihydrothieno[3,2-b]pyrrole is sourced from PubChem (CID 23521304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).