About 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine
4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine (PubChem CID 23521406) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine |
| PubChem CID | 23521406 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine |
| SMILES | CNCC(C)CCn1cnc2cccnc21 |
| InChI | InChI=1S/C12H18N4/c1-10(8-13-2)5-7-16-9-15-11-4-3-6-14-12(11)16/h3-4,6,9-10,13H,5,7-8H2,1-2H3 |
| InChIKey | QKEFBIMLICRUFW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine?
The IUPAC name of 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine (CID 23521406) is 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine.
What is the SMILES notation for 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine?
The canonical SMILES for 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine is CNCC(C)CCn1cnc2cccnc21.
What is the InChIKey of 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine?
The InChIKey is QKEFBIMLICRUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-10(8-13-2)5-7-16-9-15-11-4-3-6-14-12(11)16/h3-4,6,9-10,13H,5,7-8H2,1-2H3.
What are the key properties of 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine?
4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine has a molecular weight of 218.30 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[4,5-b]pyridin-3-yl-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 23521406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).