C11H15F3N4 — CID 23521480
N-(5-ethyl-2-methylpyrimidin-4-yl)-N'-(2,2,2-trifluoroethyl)ethanimidamide (PubChem CID 23521480) has the molecular formula C11H15F3N4 and a molecular weight of 260.26 g/mol. Its IUPAC name is N-(5-ethyl-2-methylpyrimidin-4-yl)-N'-(2,2,2-trifluoroethyl)ethanimidamide.
| Compound Name | N-(5-ethyl-2-methylpyrimidin-4-yl)-N'-(2,2,2-trifluoroethyl)ethanimidamide |
|---|---|
| PubChem CID | 23521480 |
| Molecular Formula | C11H15F3N4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-(5-ethyl-2-methylpyrimidin-4-yl)-N'-(2,2,2-trifluoroethyl)ethanimidamide |
| SMILES | CCc1cnc(C)nc1N/C(C)=N/CC(F)(F)F |
| InChI | InChI=1S/C11H15F3N4/c1-4-9-5-15-7(2)17-10(9)18-8(3)16-6-11(12,13)14/h5H,4,6H2,1-3H3,(H,15,16,17,18) |
| InChIKey | UUQLCIPUVSRYIR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|