C21H15F3N6 — CID 23521852
5-[4-(dimethylamino)phenyl]imino-2-phenyl-6-(trifluoromethyl)pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile (PubChem CID 23521852) has the molecular formula C21H15F3N6 and a molecular weight of 408.39 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]imino-2-phenyl-6-(trifluoromethyl)pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile.
| Compound Name | 5-[4-(dimethylamino)phenyl]imino-2-phenyl-6-(trifluoromethyl)pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile |
|---|---|
| PubChem CID | 23521852 |
| Molecular Formula | C21H15F3N6 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]imino-2-phenyl-6-(trifluoromethyl)pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile |
| SMILES | CN(C)c1ccc(/N=C2/C(C(F)(F)F)=C(C#N)c3nc(-c4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C21H15F3N6/c1-29(2)15-10-8-14(9-11-15)26-20-17(21(22,23)24)16(12-25)19-27-18(28-30(19)20)13-6-4-3-5-7-13/h3-11H,1-2H3/b26-20- |
| InChIKey | SELIRRZMDWCOMR-QOMWVZHYSA-N |
| XLogP | 4.44 |
| TPSA | 70.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|