C12H4S3 — CID 23522104
4,10-diethynyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 23522104) has the molecular formula C12H4S3 and a molecular weight of 244.36 g/mol. Its IUPAC name is 4,10-diethynyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-diethynyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 23522104 |
| Molecular Formula | C12H4S3 |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 4,10-diethynyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | C#Cc1cc2sc3cc(C#C)sc3c2s1 |
| InChI | InChI=1S/C12H4S3/c1-3-7-5-9-11(13-7)12-10(15-9)6-8(4-2)14-12/h1-2,5-6H |
| InChIKey | ITDBDPIGJKNUDU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|