About piperidine-3,4,5-trione
piperidine-3,4,5-trione (PubChem CID 23522237) has the molecular formula C5H5NO3
and a molecular weight of 127.10 g/mol. Its IUPAC name is piperidine-3,4,5-trione.
Molecular Properties
| Compound Name | piperidine-3,4,5-trione |
| PubChem CID | 23522237 |
| Molecular Formula | C5H5NO3 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | piperidine-3,4,5-trione |
| SMILES | O=C1CNCC(=O)C1=O |
| InChI | InChI=1S/C5H5NO3/c7-3-1-6-2-4(8)5(3)9/h6H,1-2H2 |
| InChIKey | HRSBLBCKRBVTGS-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze piperidine-3,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-3,4,5-trione?
The IUPAC name of piperidine-3,4,5-trione (CID 23522237) is piperidine-3,4,5-trione.
What is the SMILES notation for piperidine-3,4,5-trione?
The canonical SMILES for piperidine-3,4,5-trione is O=C1CNCC(=O)C1=O.
What is the InChIKey of piperidine-3,4,5-trione?
The InChIKey is HRSBLBCKRBVTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3/c7-3-1-6-2-4(8)5(3)9/h6H,1-2H2.
What are the key properties of piperidine-3,4,5-trione?
piperidine-3,4,5-trione has a molecular weight of 127.10 g/mol, XLogP of -1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-3,4,5-trione is sourced from PubChem (CID 23522237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).