C63H63N5OS — CID 23522294
2-[4-[4-[8-carbazol-9-yl-5-[4-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]nonan-3-yl]phenyl]phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole (PubChem CID 23522294) has the molecular formula C63H63N5OS and a molecular weight of 938.30 g/mol. Its IUPAC name is 2-[4-[4-[8-carbazol-9-yl-5-[4-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]nonan-3-yl]phenyl]phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[4-[8-carbazol-9-yl-5-[4-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]nonan-3-yl]phenyl]phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 23522294 |
| Molecular Formula | C63H63N5OS |
| Molecular Weight | 938.30 g/mol |
| Exact Mass | 937.48 |
| IUPAC Name | 2-[4-[4-[8-carbazol-9-yl-5-[4-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]nonan-3-yl]phenyl]phenyl]-5-(4-octylphenyl)-1,3,4-oxadiazole |
| SMILES | CCCCCCCCc1ccc(-c2nnc(-c3ccc(-c4ccc(C(CC)CC(CCC(C)n5c6ccccc6c6ccccc65)c5ccc(-c6nnc(-c7ccccc7)s6)cc5)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C63H63N5OS/c1-4-6-7-8-9-11-18-45-26-29-51(30-27-45)60-64-65-61(69-60)52-39-35-49(36-40-52)48-33-31-47(32-34-48)46(5-2)43-55(28-25-44(3)68-58-23-16-14-21-56(58)57-22-15-17-24-59(57)68)50-37-41-54(42-38-50)63-67-66-62(70-63)53-19-12-10-13-20-53/h10,12-17,19-24,26-27,29-42,44,46,55H,4-9,11,18,25,28,43H2,1-3H3 |
| InChIKey | WSQYFJWJUBWXIW-UHFFFAOYSA-N |
| XLogP | 17.98 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.30 |
| LogP ≤ 5 | 17.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|