C30H25NO4 — CID 23522334
2-[3-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]indene-1,3-dione (PubChem CID 23522334) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[3-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]indene-1,3-dione.
| Compound Name | 2-[3-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 23522334 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-[3-(4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]indene-1,3-dione |
| SMILES | O=C1C(=C2C=C(c3cc4cc5c6c(c4oc3=O)CCCN6CCC5)CCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H25NO4/c32-27-21-9-1-2-10-22(21)28(33)25(27)18-7-3-6-17(14-18)24-16-20-15-19-8-4-12-31-13-5-11-23(26(19)31)29(20)35-30(24)34/h1-2,9-10,14-16H,3-8,11-13H2 |
| InChIKey | GHLSFTSFFLGKMS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|