C34H33N3O2S — CID 23522339
(2E)-2-(1,3-benzothiazol-2-yl)-2-[3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]acetonitrile (PubChem CID 23522339) has the molecular formula C34H33N3O2S and a molecular weight of 547.72 g/mol. Its IUPAC name is (2E)-2-(1,3-benzothiazol-2-yl)-2-[3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]acetonitrile.
| Compound Name | (2E)-2-(1,3-benzothiazol-2-yl)-2-[3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 23522339 |
| Molecular Formula | C34H33N3O2S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (2E)-2-(1,3-benzothiazol-2-yl)-2-[3-(10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-5-yl)cyclohex-2-en-1-ylidene]acetonitrile |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1cc(C2=C/C(=C(\C#N)c4nc5ccccc5s4)CCC2)c(=O)oc31 |
| InChI | InChI=1S/C34H33N3O2S/c1-33(2)12-14-37-15-13-34(3,4)28-29(37)25(33)18-22-17-23(32(38)39-30(22)28)20-8-7-9-21(16-20)24(19-35)31-36-26-10-5-6-11-27(26)40-31/h5-6,10-11,16-18H,7-9,12-15H2,1-4H3/b24-21+ |
| InChIKey | CRPNHJUIUCSYGA-DARPEHSRSA-N |
| XLogP | 8.12 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|