About 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene (PubChem CID 23522599) has the molecular formula C14H24O4S
and a molecular weight of 288.41 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene.
Molecular Properties
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene |
| PubChem CID | 23522599 |
| Molecular Formula | C14H24O4S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene |
| SMILES | COCCOCCOCCOc1c(C)sc(C)c1C |
| InChI | InChI=1S/C14H24O4S/c1-11-12(2)19-13(3)14(11)18-10-9-17-8-7-16-6-5-15-4/h5-10H2,1-4H3 |
| InChIKey | PNTCXBFYAAETGT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene?
The IUPAC name of 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene (CID 23522599) is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene.
What is the SMILES notation for 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene?
The canonical SMILES for 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene is COCCOCCOCCOc1c(C)sc(C)c1C.
What is the InChIKey of 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene?
The InChIKey is PNTCXBFYAAETGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4S/c1-11-12(2)19-13(3)14(11)18-10-9-17-8-7-16-6-5-15-4/h5-10H2,1-4H3.
What are the key properties of 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene?
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene has a molecular weight of 288.41 g/mol, XLogP of 2.73, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,4,5-trimethylthiophene is sourced from PubChem (CID 23522599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).