About 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one
1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one (PubChem CID 23522804) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one.
Molecular Properties
| Compound Name | 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one |
| PubChem CID | 23522804 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one |
| SMILES | CC1(O)CCC2(CC1)OC(=O)c1c2ccc[n+]1[O-] |
| InChI | InChI=1S/C13H15NO4/c1-12(16)4-6-13(7-5-12)9-3-2-8-14(17)10(9)11(15)18-13/h2-3,8,16H,4-7H2,1H3 |
| InChIKey | NBACPBGJQQYKKE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one?
The IUPAC name of 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one (CID 23522804) is 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one.
What is the SMILES notation for 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one?
The canonical SMILES for 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one is CC1(O)CCC2(CC1)OC(=O)c1c2ccc[n+]1[O-].
What is the InChIKey of 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one?
The InChIKey is NBACPBGJQQYKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-12(16)4-6-13(7-5-12)9-3-2-8-14(17)10(9)11(15)18-13/h2-3,8,16H,4-7H2,1H3.
What are the key properties of 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one?
1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one has a molecular weight of 249.27 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-1-methyl-1'-oxidospiro[cyclohexane-4,5'-furo[3,4-b]pyridin-1-ium]-7'-one is sourced from PubChem (CID 23522804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).