About 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one
1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one (PubChem CID 23522807) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one.
Molecular Properties
| Compound Name | 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one |
| PubChem CID | 23522807 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one |
| SMILES | CC1(O)CCC2(CC1)OC(=O)c1cnccc12 |
| InChI | InChI=1S/C13H15NO3/c1-12(16)3-5-13(6-4-12)10-2-7-14-8-9(10)11(15)17-13/h2,7-8,16H,3-6H2,1H3 |
| InChIKey | GSXSBXBZGCHCLS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one?
The IUPAC name of 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one (CID 23522807) is 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one.
What is the SMILES notation for 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one?
The canonical SMILES for 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one is CC1(O)CCC2(CC1)OC(=O)c1cnccc12.
What is the InChIKey of 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one?
The InChIKey is GSXSBXBZGCHCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-12(16)3-5-13(6-4-12)10-2-7-14-8-9(10)11(15)17-13/h2,7-8,16H,3-6H2,1H3.
What are the key properties of 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one?
1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one has a molecular weight of 233.27 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-1-methylspiro[cyclohexane-4,1'-furo[3,4-c]pyridine]-3'-one is sourced from PubChem (CID 23522807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).