C15H21N — CID 23522829
2-(2,3,3-trimethylbutyl)-1H-indole (PubChem CID 23522829) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(2,3,3-trimethylbutyl)-1H-indole.
| Compound Name | 2-(2,3,3-trimethylbutyl)-1H-indole |
|---|---|
| PubChem CID | 23522829 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-(2,3,3-trimethylbutyl)-1H-indole |
| SMILES | CC(Cc1cc2ccccc2[nH]1)C(C)(C)C |
| InChI | InChI=1S/C15H21N/c1-11(15(2,3)4)9-13-10-12-7-5-6-8-14(12)16-13/h5-8,10-11,16H,9H2,1-4H3 |
| InChIKey | UVEWPJNYHGTZFO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |