About [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 2352315) has the molecular formula C19H17BrN2O3
and a molecular weight of 401.26 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate.
Molecular Properties
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
| PubChem CID | 2352315 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | N#CCCN(C(=O)COC(=O)Cc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H17BrN2O3/c20-16-9-7-15(8-10-16)13-19(24)25-14-18(23)22(12-4-11-21)17-5-2-1-3-6-17/h1-3,5-10H,4,12-14H2 |
| InChIKey | JKUIGTQYMKTEDW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate?
The IUPAC name of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate (CID 2352315) is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate.
What is the SMILES notation for [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate?
The canonical SMILES for [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate is N#CCCN(C(=O)COC(=O)Cc1ccc(Br)cc1)c1ccccc1.
What is the InChIKey of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate?
The InChIKey is JKUIGTQYMKTEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrN2O3/c20-16-9-7-15(8-10-16)13-19(24)25-14-18(23)22(12-4-11-21)17-5-2-1-3-6-17/h1-3,5-10H,4,12-14H2.
What are the key properties of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate?
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate has a molecular weight of 401.26 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-(4-bromophenyl)acetate is sourced from PubChem (CID 2352315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).