C10H10ClF13O2Si — CID 23523519
chloro-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-diethoxysilane (PubChem CID 23523519) has the molecular formula C10H10ClF13O2Si and a molecular weight of 472.70 g/mol. Its IUPAC name is chloro-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-diethoxysilane.
| Compound Name | chloro-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-diethoxysilane |
|---|---|
| PubChem CID | 23523519 |
| Molecular Formula | C10H10ClF13O2Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | chloro-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-diethoxysilane |
| SMILES | CCO[Si](Cl)(OCC)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF13O2Si/c1-3-25-27(11,26-4-2)5(8(16,17)18,9(19,20)21)6(12,13)7(14,15)10(22,23)24/h3-4H2,1-2H3 |
| InChIKey | XJNJMTVTBACQAD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|