C11H10ClF7O2Si — CID 23523522
chloro-diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane (PubChem CID 23523522) has the molecular formula C11H10ClF7O2Si and a molecular weight of 370.72 g/mol. Its IUPAC name is chloro-diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane.
| Compound Name | chloro-diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 23523522 |
| Molecular Formula | C11H10ClF7O2Si |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | chloro-diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| SMILES | CCO[Si](Cl)(OCC)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C11H10ClF7O2Si/c1-3-20-22(12,21-4-2)10-8(15)6(13)5(11(17,18)19)7(14)9(10)16/h3-4H2,1-2H3 |
| InChIKey | BWSBNOIRIKEBHA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|