C11H5ClF10OSi — CID 23523528
chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane (PubChem CID 23523528) has the molecular formula C11H5ClF10OSi and a molecular weight of 406.68 g/mol. Its IUPAC name is chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane.
| Compound Name | chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane |
|---|---|
| PubChem CID | 23523528 |
| Molecular Formula | C11H5ClF10OSi |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane |
| SMILES | CCO[Si](Cl)(C(F)=C(F)F)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C11H5ClF10OSi/c1-2-23-24(12,10(19)9(17)18)8-6(15)4(13)3(11(20,21)22)5(14)7(8)16/h2H2,1H3 |
| InChIKey | JVBOBRIDGDZZTR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|