C17H5ClF14OSi — CID 23523529
chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane (PubChem CID 23523529) has the molecular formula C17H5ClF14OSi and a molecular weight of 554.74 g/mol. Its IUPAC name is chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane.
| Compound Name | chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 23523529 |
| Molecular Formula | C17H5ClF14OSi |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | chloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| SMILES | CCO[Si](Cl)(c1c(F)c(F)c(C(F)=C(F)F)c(F)c1F)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C17H5ClF14OSi/c1-2-33-34(18,15-12(26)8(22)4(17(30,31)32)9(23)13(15)27)14-10(24)5(19)3(6(20)11(14)25)7(21)16(28)29/h2H2,1H3 |
| InChIKey | PEPDFRXJTOSDPN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|