C14H5ClF10OSi — CID 23523532
chloro-ethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 23523532) has the molecular formula C14H5ClF10OSi and a molecular weight of 442.71 g/mol. Its IUPAC name is chloro-ethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | chloro-ethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 23523532 |
| Molecular Formula | C14H5ClF10OSi |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | chloro-ethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CCO[Si](Cl)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H5ClF10OSi/c1-2-26-27(15,13-9(22)5(18)3(16)6(19)10(13)23)14-11(24)7(20)4(17)8(21)12(14)25/h2H2,1H3 |
| InChIKey | QEBJSMSZVJTECS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|