C16H5ClF14OSi — CID 23523533
chloro-ethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane (PubChem CID 23523533) has the molecular formula C16H5ClF14OSi and a molecular weight of 542.73 g/mol. Its IUPAC name is chloro-ethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane.
| Compound Name | chloro-ethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 23523533 |
| Molecular Formula | C16H5ClF14OSi |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 541.96 |
| IUPAC Name | chloro-ethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| SMILES | CCO[Si](Cl)(c1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C16H5ClF14OSi/c1-2-32-33(17,13-9(22)5(18)3(15(26,27)28)6(19)10(13)23)14-11(24)7(20)4(16(29,30)31)8(21)12(14)25/h2H2,1H3 |
| InChIKey | MHUHSIYAPUYVSB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|