C10H5Cl2F7OSi — CID 23523553
dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane (PubChem CID 23523553) has the molecular formula C10H5Cl2F7OSi and a molecular weight of 373.13 g/mol. Its IUPAC name is dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane.
| Compound Name | dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane |
|---|---|
| PubChem CID | 23523553 |
| Molecular Formula | C10H5Cl2F7OSi |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]silane |
| SMILES | CCO[Si](Cl)(Cl)c1c(F)c(F)c(C(F)=C(F)F)c(F)c1F |
| InChI | InChI=1S/C10H5Cl2F7OSi/c1-2-20-21(11,12)9-7(16)4(13)3(5(14)8(9)17)6(15)10(18)19/h2H2,1H3 |
| InChIKey | RLVSMXLTKZVXFA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|