C9H5Cl2F7OSi — CID 23523554
dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane (PubChem CID 23523554) has the molecular formula C9H5Cl2F7OSi and a molecular weight of 361.12 g/mol. Its IUPAC name is dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane.
| Compound Name | dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 23523554 |
| Molecular Formula | C9H5Cl2F7OSi |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | dichloro-ethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| SMILES | CCO[Si](Cl)(Cl)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C9H5Cl2F7OSi/c1-2-19-20(10,11)8-6(14)4(12)3(9(16,17)18)5(13)7(8)15/h2H2,1H3 |
| InChIKey | XZKGKTZZCWLPOP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|