C12H13F5O2Si — CID 23523559
ethenyl-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 23523559) has the molecular formula C12H13F5O2Si and a molecular weight of 312.31 g/mol. Its IUPAC name is ethenyl-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | ethenyl-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 23523559 |
| Molecular Formula | C12H13F5O2Si |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | ethenyl-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C=C[Si](OCC)(OCC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5O2Si/c1-4-18-20(6-3,19-5-2)12-10(16)8(14)7(13)9(15)11(12)17/h6H,3-5H2,1-2H3 |
| InChIKey | FNEOEUCCJWSPLN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|