C13H10F10O2Si — CID 23523560
diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane (PubChem CID 23523560) has the molecular formula C13H10F10O2Si and a molecular weight of 416.29 g/mol. Its IUPAC name is diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane.
| Compound Name | diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane |
|---|---|
| PubChem CID | 23523560 |
| Molecular Formula | C13H10F10O2Si |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | diethoxy-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-(1,2,2-trifluoroethenyl)silane |
| SMILES | CCO[Si](OCC)(C(F)=C(F)F)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H10F10O2Si/c1-3-24-26(25-4-2,12(20)11(18)19)10-8(16)6(14)5(13(21,22)23)7(15)9(10)17/h3-4H2,1-2H3 |
| InChIKey | SPAJUIKYXJJZBD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|