C12H15F13O3Si — CID 23523579
[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-triethoxysilane (PubChem CID 23523579) has the molecular formula C12H15F13O3Si and a molecular weight of 482.31 g/mol. Its IUPAC name is [1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-triethoxysilane.
| Compound Name | [1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-triethoxysilane |
|---|---|
| PubChem CID | 23523579 |
| Molecular Formula | C12H15F13O3Si |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | [1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F13O3Si/c1-4-26-29(27-5-2,28-6-3)7(10(17,18)19,11(20,21)22)8(13,14)9(15,16)12(23,24)25/h4-6H2,1-3H3 |
| InChIKey | RRZQZZCSBANXOT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|