C19H18N- — CID 23523773
2-(2-methylpropyl)-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine (PubChem CID 23523773) has the molecular formula C19H18N- and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine.
| Compound Name | 2-(2-methylpropyl)-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine |
|---|---|
| PubChem CID | 23523773 |
| Molecular Formula | C19H18N- |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(2-methylpropyl)-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine |
| SMILES | [CH-]=C=C=C=C=C=C=C=C=C=CN1CCCC1CC(C)C |
| InChI | InChI=1S/C19H18N/c1-4-5-6-7-8-9-10-11-12-15-20-16-13-14-19(20)17-18(2)3/h1,15,18-19H,13-14,16-17H2,2-3H3/q-1 |
| InChIKey | FSBZZPWRXOXZND-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|