C18H16N- — CID 23523775
2-propan-2-yl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine (PubChem CID 23523775) has the molecular formula C18H16N- and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-propan-2-yl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine.
| Compound Name | 2-propan-2-yl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine |
|---|---|
| PubChem CID | 23523775 |
| Molecular Formula | C18H16N- |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-propan-2-yl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine |
| SMILES | [CH-]=C=C=C=C=C=C=C=C=C=CN1CCCC1C(C)C |
| InChI | InChI=1S/C18H16N/c1-4-5-6-7-8-9-10-11-12-15-19-16-13-14-18(19)17(2)3/h1,15,17-18H,13-14,16H2,2-3H3/q-1 |
| InChIKey | MDISYUWKBRNHLZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|