C17H13N2O- — CID 23523791
N-methyl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine-2-carboxamide (PubChem CID 23523791) has the molecular formula C17H13N2O- and a molecular weight of 261.30 g/mol. Its IUPAC name is N-methyl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine-2-carboxamide.
| Compound Name | N-methyl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23523791 |
| Molecular Formula | C17H13N2O- |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-methyl-1-undeca-1,2,3,4,5,6,7,8,9,10-decaenylpyrrolidine-2-carboxamide |
| SMILES | [CH-]=C=C=C=C=C=C=C=C=C=CN1CCCC1C(=O)NC |
| InChI | InChI=1S/C17H13N2O/c1-3-4-5-6-7-8-9-10-11-14-19-15-12-13-16(19)17(20)18-2/h1,14,16H,12-13,15H2,2H3,(H,18,20)/q-1 |
| InChIKey | KUIGHLOZVZPBER-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|