C15H25N3Si — CID 23524153
2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl-dimethyl-(2-methylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 23524153) has the molecular formula C15H25N3Si and a molecular weight of 275.47 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl-dimethyl-(2-methylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | 2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl-dimethyl-(2-methylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 23524153 |
| Molecular Formula | C15H25N3Si |
| Molecular Weight | 275.47 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl-dimethyl-(2-methylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC=CC1[Si](C)(C)N1CCCN2CCCN=C21 |
| InChI | InChI=1S/C15H25N3Si/c1-13-7-4-8-14(13)19(2,3)18-12-6-11-17-10-5-9-16-15(17)18/h4,7-8,14H,5-6,9-12H2,1-3H3 |
| InChIKey | DDPPSFQPLXJBEG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|