C28H37N5O3 — CID 23524441
1,7-diacetyl-4-[2-(dimethylamino)ethyl]-9-methyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one (PubChem CID 23524441) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 1,7-diacetyl-4-[2-(dimethylamino)ethyl]-9-methyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one.
| Compound Name | 1,7-diacetyl-4-[2-(dimethylamino)ethyl]-9-methyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one |
|---|---|
| PubChem CID | 23524441 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1,7-diacetyl-4-[2-(dimethylamino)ethyl]-9-methyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one |
| SMILES | CC(=O)C12CCN(CCN(C)C)CCC(C(C)=O)(C1=O)C(c1ccccn1)N(C)C2c1ccccn1 |
| InChI | InChI=1S/C28H37N5O3/c1-20(34)27-12-16-33(19-18-31(3)4)17-13-28(21(2)35,26(27)36)25(23-11-7-9-15-30-23)32(5)24(27)22-10-6-8-14-29-22/h6-11,14-15,24-25H,12-13,16-19H2,1-5H3 |
| InChIKey | PJLZPXOWWZKBCJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|