About tetracyclo[6.3.0.02,6.03,11]undecane
tetracyclo[6.3.0.02,6.03,11]undecane (PubChem CID 23524841) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is tetracyclo[6.3.0.02,6.03,11]undecane.
Molecular Properties
| Compound Name | tetracyclo[6.3.0.02,6.03,11]undecane |
| PubChem CID | 23524841 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | tetracyclo[6.3.0.02,6.03,11]undecane |
| SMILES | C1CC2C3CCC4CC1C2C43 |
| InChI | InChI=1S/C11H16/c1-3-8-9-4-2-7-5-6(1)10(8)11(7)9/h6-11H,1-5H2 |
| InChIKey | WBXVNOARFXGUQC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetracyclo[6.3.0.02,6.03,11]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[6.3.0.02,6.03,11]undecane?
The IUPAC name of tetracyclo[6.3.0.02,6.03,11]undecane (CID 23524841) is tetracyclo[6.3.0.02,6.03,11]undecane.
What is the SMILES notation for tetracyclo[6.3.0.02,6.03,11]undecane?
The canonical SMILES for tetracyclo[6.3.0.02,6.03,11]undecane is C1CC2C3CCC4CC1C2C43.
What is the InChIKey of tetracyclo[6.3.0.02,6.03,11]undecane?
The InChIKey is WBXVNOARFXGUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-3-8-9-4-2-7-5-6(1)10(8)11(7)9/h6-11H,1-5H2.
What are the key properties of tetracyclo[6.3.0.02,6.03,11]undecane?
tetracyclo[6.3.0.02,6.03,11]undecane has a molecular weight of 148.25 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[6.3.0.02,6.03,11]undecane is sourced from PubChem (CID 23524841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).