C8H14N4O2 — CID 23525147
2,6-diamino-3-(2-ethoxyethyl)pyrimidin-4-one (PubChem CID 23525147) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2,6-diamino-3-(2-ethoxyethyl)pyrimidin-4-one.
| Compound Name | 2,6-diamino-3-(2-ethoxyethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 23525147 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2,6-diamino-3-(2-ethoxyethyl)pyrimidin-4-one |
| SMILES | CCOCCn1c(N)nc(N)cc1=O |
| InChI | InChI=1S/C8H14N4O2/c1-2-14-4-3-12-7(13)5-6(9)11-8(12)10/h5H,2-4,9H2,1H3,(H2,10,11) |
| InChIKey | ULNAGSKBQPPTAX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|