About 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one
2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one (PubChem CID 23525157) has the molecular formula C7H11N3O4
and a molecular weight of 201.18 g/mol. Its IUPAC name is 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one |
| PubChem CID | 23525157 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(OCC(O)CO)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O4/c8-7-9-5(13)1-6(10-7)14-3-4(12)2-11/h1,4,11-12H,2-3H2,(H3,8,9,10,13) |
| InChIKey | FHBPQKBBYHYZKB-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one?
The IUPAC name of 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one (CID 23525157) is 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one?
The canonical SMILES for 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one is Nc1nc(OCC(O)CO)cc(=O)[nH]1.
What is the InChIKey of 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one?
The InChIKey is FHBPQKBBYHYZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O4/c8-7-9-5(13)1-6(10-7)14-3-4(12)2-11/h1,4,11-12H,2-3H2,(H3,8,9,10,13).
What are the key properties of 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one?
2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one has a molecular weight of 201.18 g/mol, XLogP of -1.92, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,3-dihydroxypropoxy)-1H-pyrimidin-6-one is sourced from PubChem (CID 23525157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).