C30H44N10O4W — CID 23525613
bis([4-[4-amino-2-(ethoxymethyl)-7-methylimidazo[4,5-c]pyridin-1-yl]butylamino]methanone);tungsten(2+) (PubChem CID 23525613) has the molecular formula C30H44N10O4W and a molecular weight of 792.59 g/mol. Its IUPAC name is bis([4-[4-amino-2-(ethoxymethyl)-7-methylimidazo[4,5-c]pyridin-1-yl]butylamino]methanone);tungsten(2+).
| Compound Name | bis([4-[4-amino-2-(ethoxymethyl)-7-methylimidazo[4,5-c]pyridin-1-yl]butylamino]methanone);tungsten(2+) |
|---|---|
| PubChem CID | 23525613 |
| Molecular Formula | C30H44N10O4W |
| Molecular Weight | 792.59 g/mol |
| Exact Mass | 792.31 |
| IUPAC Name | bis([4-[4-amino-2-(ethoxymethyl)-7-methylimidazo[4,5-c]pyridin-1-yl]butylamino]methanone);tungsten(2+) |
| SMILES | CCOCc1nc2c(N)ncc(C)c2n1CCCCN[C-]=O.CCOCc1nc2c(N)ncc(C)c2n1CCCCN[C-]=O.[W+2] |
| InChI | InChI=1S/2C15H22N5O2.W/c2*1-3-22-9-12-19-13-14(11(2)8-18-15(13)16)20(12)7-5-4-6-17-10-21;/h2*8H,3-7,9H2,1-2H3,(H2,16,18)(H,17,21);/q2*-1;+2 |
| InChIKey | KQVLKKXABANTQA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 190.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|