C18H23ClN4O2 — CID 23525647
tert-butyl 4-[2-[(1S)-1-azidoethyl]-4-chlorophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 23525647) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is tert-butyl 4-[2-[(1S)-1-azidoethyl]-4-chlorophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(1S)-1-azidoethyl]-4-chlorophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 23525647 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | tert-butyl 4-[2-[(1S)-1-azidoethyl]-4-chlorophenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@H](N=[N+]=[N-])c1cc(Cl)ccc1C1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-12(21-22-20)16-11-14(19)5-6-15(16)13-7-9-23(10-8-13)17(24)25-18(2,3)4/h5-7,11-12H,8-10H2,1-4H3/t12-/m0/s1 |
| InChIKey | BZYSCSKWWKZQNO-LBPRGKRZSA-N |
| XLogP | 5.74 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|