About N-methyl-1,3-oxazole-5-carboxamide
N-methyl-1,3-oxazole-5-carboxamide (PubChem CID 23525717) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is N-methyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-methyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 23525717 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | N-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CNC(=O)c1cnco1 |
| InChI | InChI=1S/C5H6N2O2/c1-6-5(8)4-2-7-3-9-4/h2-3H,1H3,(H,6,8) |
| InChIKey | YKJFVDFPTHDPNO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,3-oxazole-5-carboxamide?
The IUPAC name of N-methyl-1,3-oxazole-5-carboxamide (CID 23525717) is N-methyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-methyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-methyl-1,3-oxazole-5-carboxamide is CNC(=O)c1cnco1.
What is the InChIKey of N-methyl-1,3-oxazole-5-carboxamide?
The InChIKey is YKJFVDFPTHDPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c1-6-5(8)4-2-7-3-9-4/h2-3H,1H3,(H,6,8).
What are the key properties of N-methyl-1,3-oxazole-5-carboxamide?
N-methyl-1,3-oxazole-5-carboxamide has a molecular weight of 126.11 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 23525717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).